C25H32NO3+ — CID 25032027
(3,3-dimethyl-3-azoniabicyclo[3.2.1]octan-8-yl)methyl 2-hydroxy-2-(4-methylphenyl)-2-phenylacetate (PubChem CID 25032027) has the molecular formula C25H32NO3+ and a molecular weight of 394.53 g/mol. Its IUPAC name is (3,3-dimethyl-3-azoniabicyclo[3.2.1]octan-8-yl)methyl 2-hydroxy-2-(4-methylphenyl)-2-phenylacetate.
| Compound Name | (3,3-dimethyl-3-azoniabicyclo[3.2.1]octan-8-yl)methyl 2-hydroxy-2-(4-methylphenyl)-2-phenylacetate |
|---|---|
| PubChem CID | 25032027 |
| Molecular Formula | C25H32NO3+ |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (3,3-dimethyl-3-azoniabicyclo[3.2.1]octan-8-yl)methyl 2-hydroxy-2-(4-methylphenyl)-2-phenylacetate |
| SMILES | Cc1ccc(C(O)(C(=O)OCC2C3CCC2C[N+](C)(C)C3)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H32NO3/c1-18-9-13-22(14-10-18)25(28,21-7-5-4-6-8-21)24(27)29-17-23-19-11-12-20(23)16-26(2,3)15-19/h4-10,13-14,19-20,23,28H,11-12,15-17H2,1-3H3/q+1 |
| InChIKey | UFFBDSPABLWFDD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|