C27H31N2O3+ — CID 67328164
[(2R)-1-methyl-1-(2-pyridin-4-ylethyl)pyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 67328164) has the molecular formula C27H31N2O3+ and a molecular weight of 431.56 g/mol. Its IUPAC name is [(2R)-1-methyl-1-(2-pyridin-4-ylethyl)pyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(2R)-1-methyl-1-(2-pyridin-4-ylethyl)pyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 67328164 |
| Molecular Formula | C27H31N2O3+ |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | [(2R)-1-methyl-1-(2-pyridin-4-ylethyl)pyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | C[N+]1(CCc2ccncc2)CCC[C@@H]1COC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31N2O3/c1-29(20-16-22-14-17-28-18-15-22)19-8-13-25(29)21-32-26(30)27(31,23-9-4-2-5-10-23)24-11-6-3-7-12-24/h2-7,9-12,14-15,17-18,25,31H,8,13,16,19-21H2,1H3/q+1/t25-,29?/m1/s1 |
| InChIKey | CXFMHZKFZVOWTG-MIJJZIGMSA-N |
| XLogP | 3.71 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|