C28H33N2O3+ — CID 66902641
[(2R)-1-methyl-1-(3-pyridin-4-ylpropyl)pyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 66902641) has the molecular formula C28H33N2O3+ and a molecular weight of 445.58 g/mol. Its IUPAC name is [(2R)-1-methyl-1-(3-pyridin-4-ylpropyl)pyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(2R)-1-methyl-1-(3-pyridin-4-ylpropyl)pyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 66902641 |
| Molecular Formula | C28H33N2O3+ |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | [(2R)-1-methyl-1-(3-pyridin-4-ylpropyl)pyrrolidin-1-ium-2-yl]methyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | C[N+]1(CCCc2ccncc2)CCC[C@@H]1COC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33N2O3/c1-30(20-8-10-23-16-18-29-19-17-23)21-9-15-26(30)22-33-27(31)28(32,24-11-4-2-5-12-24)25-13-6-3-7-14-25/h2-7,11-14,16-19,26,32H,8-10,15,20-22H2,1H3/q+1/t26-,30?/m1/s1 |
| InChIKey | UZTBMDJSBHNFOQ-FIQOPJFZSA-N |
| XLogP | 4.10 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|