C29H40NO3+ — CID 66901927
[(2R)-1-methyl-1-(3-phenylpropyl)pyrrolidin-1-ium-2-yl]methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 66901927) has the molecular formula C29H40NO3+ and a molecular weight of 450.64 g/mol. Its IUPAC name is [(2R)-1-methyl-1-(3-phenylpropyl)pyrrolidin-1-ium-2-yl]methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(2R)-1-methyl-1-(3-phenylpropyl)pyrrolidin-1-ium-2-yl]methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 66901927 |
| Molecular Formula | C29H40NO3+ |
| Molecular Weight | 450.64 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | [(2R)-1-methyl-1-(3-phenylpropyl)pyrrolidin-1-ium-2-yl]methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N+]1(CCCc2ccccc2)CCC[C@@H]1COC(=O)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C29H40NO3/c1-30(21-11-15-24-13-5-2-6-14-24)22-12-20-27(30)23-33-28(31)29(32,25-16-7-3-8-17-25)26-18-9-4-10-19-26/h2-3,5-8,13-14,16-17,26-27,32H,4,9-12,15,18-23H2,1H3/q+1/t27-,29?,30?/m1/s1 |
| InChIKey | AYBDPPICMUDFLI-WWUHRCHBSA-N |
| XLogP | 5.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.64 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|