C24H35N2O4+ — CID 68944543
[(1R)-1-methyl-1-[2-(5H-1,2-oxazol-2-yl)ethyl]pyrrolidin-1-ium-2-yl]methyl 2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 68944543) has the molecular formula C24H35N2O4+ and a molecular weight of 415.55 g/mol. Its IUPAC name is [(1R)-1-methyl-1-[2-(5H-1,2-oxazol-2-yl)ethyl]pyrrolidin-1-ium-2-yl]methyl 2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(1R)-1-methyl-1-[2-(5H-1,2-oxazol-2-yl)ethyl]pyrrolidin-1-ium-2-yl]methyl 2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 68944543 |
| Molecular Formula | C24H35N2O4+ |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | [(1R)-1-methyl-1-[2-(5H-1,2-oxazol-2-yl)ethyl]pyrrolidin-1-ium-2-yl]methyl 2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N@+]1(CCN2C=CCO2)CCCC1COC(=O)C(O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C24H35N2O4/c1-26(17-15-25-14-8-18-30-25)16-7-13-22(26)19-29-23(27)24(28,21-11-5-6-12-21)20-9-3-2-4-10-20/h2-4,8-10,14,21-22,28H,5-7,11-13,15-19H2,1H3/q+1/t22?,24?,26-/m1/s1 |
| InChIKey | PRBGEPWQAVTOEB-HNHZEOAVSA-N |
| XLogP | 2.98 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|