C25H34N3O3+ — CID 66901969
[(2R)-1-methyl-1-(2-pyrimidin-2-ylethyl)pyrrolidin-1-ium-2-yl]methyl 2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 66901969) has the molecular formula C25H34N3O3+ and a molecular weight of 424.57 g/mol. Its IUPAC name is [(2R)-1-methyl-1-(2-pyrimidin-2-ylethyl)pyrrolidin-1-ium-2-yl]methyl 2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(2R)-1-methyl-1-(2-pyrimidin-2-ylethyl)pyrrolidin-1-ium-2-yl]methyl 2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 66901969 |
| Molecular Formula | C25H34N3O3+ |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | [(2R)-1-methyl-1-(2-pyrimidin-2-ylethyl)pyrrolidin-1-ium-2-yl]methyl 2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N+]1(CCc2ncccn2)CCC[C@@H]1COC(=O)C(O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C25H34N3O3/c1-28(18-14-23-26-15-8-16-27-23)17-7-13-22(28)19-31-24(29)25(30,21-11-5-6-12-21)20-9-3-2-4-10-20/h2-4,8-10,15-16,21-22,30H,5-7,11-14,17-19H2,1H3/q+1/t22-,25?,28?/m1/s1 |
| InChIKey | WQPBOOJUTCSYJN-WQYTUBPHSA-N |
| XLogP | 3.25 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|