C28H39N2O3+ — CID 66902262
[1-methyl-1-(3-pyridin-2-ylpropyl)pyrrolidin-1-ium-2-yl]methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 66902262) has the molecular formula C28H39N2O3+ and a molecular weight of 451.63 g/mol. Its IUPAC name is [1-methyl-1-(3-pyridin-2-ylpropyl)pyrrolidin-1-ium-2-yl]methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [1-methyl-1-(3-pyridin-2-ylpropyl)pyrrolidin-1-ium-2-yl]methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 66902262 |
| Molecular Formula | C28H39N2O3+ |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | [1-methyl-1-(3-pyridin-2-ylpropyl)pyrrolidin-1-ium-2-yl]methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N+]1(CCCc2ccccn2)CCCC1COC(=O)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C28H39N2O3/c1-30(20-10-17-25-16-8-9-19-29-25)21-11-18-26(30)22-33-27(31)28(32,23-12-4-2-5-13-23)24-14-6-3-7-15-24/h2,4-5,8-9,12-13,16,19,24,26,32H,3,6-7,10-11,14-15,17-18,20-22H2,1H3/q+1 |
| InChIKey | WJZYGCDTLSNURW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|