C23H27NO3 — CID 68553182
3-azabicyclo[3.2.1]octan-8-ylmethyl 2-hydroxy-2-(4-methylphenyl)-2-phenylacetate (PubChem CID 68553182) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 3-azabicyclo[3.2.1]octan-8-ylmethyl 2-hydroxy-2-(4-methylphenyl)-2-phenylacetate.
| Compound Name | 3-azabicyclo[3.2.1]octan-8-ylmethyl 2-hydroxy-2-(4-methylphenyl)-2-phenylacetate |
|---|---|
| PubChem CID | 68553182 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 3-azabicyclo[3.2.1]octan-8-ylmethyl 2-hydroxy-2-(4-methylphenyl)-2-phenylacetate |
| SMILES | Cc1ccc(C(O)(C(=O)OCC2C3CCC2CNC3)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO3/c1-16-7-11-20(12-8-16)23(26,19-5-3-2-4-6-19)22(25)27-15-21-17-9-10-18(21)14-24-13-17/h2-8,11-12,17-18,21,24,26H,9-10,13-15H2,1H3 |
| InChIKey | QQKSMXLURNZFLJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |