C21H24O3 — CID 7191546
cyclohexylmethyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 7191546) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is cyclohexylmethyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | cyclohexylmethyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 7191546 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | cyclohexylmethyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(OCC1CCCCC1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24O3/c22-20(24-16-17-10-4-1-5-11-17)21(23,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h2-3,6-9,12-15,17,23H,1,4-5,10-11,16H2 |
| InChIKey | VDRIHFRTVPYNAS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |