C13H22O4 — CID 54253433
4-(cyclohexylmethoxy)-3,3-dimethyl-4-oxobutanoic acid (PubChem CID 54253433) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 4-(cyclohexylmethoxy)-3,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(cyclohexylmethoxy)-3,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54253433 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4-(cyclohexylmethoxy)-3,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C)(CC(=O)O)C(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C13H22O4/c1-13(2,8-11(14)15)12(16)17-9-10-6-4-3-5-7-10/h10H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | QYJBHTBKGVTREF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |