C17H26ClNO2 — CID 162724550
cyclohexylmethyl (2S)-2-amino-2-methyl-3-phenylpropanoate;hydrochloride (PubChem CID 162724550) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is cyclohexylmethyl (2S)-2-amino-2-methyl-3-phenylpropanoate;hydrochloride.
| Compound Name | cyclohexylmethyl (2S)-2-amino-2-methyl-3-phenylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 162724550 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | cyclohexylmethyl (2S)-2-amino-2-methyl-3-phenylpropanoate;hydrochloride |
| SMILES | C[C@](N)(Cc1ccccc1)C(=O)OCC1CCCCC1.Cl |
| InChI | InChI=1S/C17H25NO2.ClH/c1-17(18,12-14-8-4-2-5-9-14)16(19)20-13-15-10-6-3-7-11-15;/h2,4-5,8-9,15H,3,6-7,10-13,18H2,1H3;1H/t17-;/m0./s1 |
| InChIKey | VLZCCABPMKZENI-LMOVPXPDSA-N |
| XLogP | 3.49 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |