C22H25NO4 — CID 2676355
[2-(cyclohexylamino)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 2676355) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 2676355 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(COC(=O)C(O)(c1ccccc1)c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C22H25NO4/c24-20(23-19-14-8-3-9-15-19)16-27-21(25)22(26,17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-2,4-7,10-13,19,26H,3,8-9,14-16H2,(H,23,24) |
| InChIKey | WHGNYNGWMLALOY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |