C28H28N2O5 — CID 16500353
[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 16500353) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 16500353 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(COC(=O)C(O)(c1ccccc1)c1ccccc1)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C28H28N2O5/c31-25(30-24-18-10-9-17-23(24)26(32)29-22-15-7-8-16-22)19-35-27(33)28(34,20-11-3-1-4-12-20)21-13-5-2-6-14-21/h1-6,9-14,17-18,22,34H,7-8,15-16,19H2,(H,29,32)(H,30,31) |
| InChIKey | AXRRSHCYVXPHRT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |