C20H27NO3 — CID 11602361
3-azabicyclo[3.2.1]octan-8-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 11602361) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 3-azabicyclo[3.2.1]octan-8-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | 3-azabicyclo[3.2.1]octan-8-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 11602361 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 3-azabicyclo[3.2.1]octan-8-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | O=C(OC1C2CCC1CNC2)C(O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C20H27NO3/c22-19(24-18-14-10-11-15(18)13-21-12-14)20(23,17-8-4-5-9-17)16-6-2-1-3-7-16/h1-3,6-7,14-15,17-18,21,23H,4-5,8-13H2 |
| InChIKey | WRDHRFJXXYITHE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |