C18H26ClNO3 — CID 134123321
piperidin-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate;hydrochloride (PubChem CID 134123321) has the molecular formula C18H26ClNO3 and a molecular weight of 339.86 g/mol. Its IUPAC name is piperidin-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate;hydrochloride.
| Compound Name | piperidin-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate;hydrochloride |
|---|---|
| PubChem CID | 134123321 |
| Molecular Formula | C18H26ClNO3 |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | piperidin-3-yl 2-cyclopentyl-2-hydroxy-2-phenylacetate;hydrochloride |
| SMILES | Cl.O=C(OC1CCCNC1)C(O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C18H25NO3.ClH/c20-17(22-16-11-6-12-19-13-16)18(21,15-9-4-5-10-15)14-7-2-1-3-8-14;/h1-3,7-8,15-16,19,21H,4-6,9-13H2;1H |
| InChIKey | URDTUOSXUSZILC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |