C28H35NO3 — CID 11582875
(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl) 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 11582875) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is (3-benzyl-3-azabicyclo[3.2.1]octan-8-yl) 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | (3-benzyl-3-azabicyclo[3.2.1]octan-8-yl) 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 11582875 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | (3-benzyl-3-azabicyclo[3.2.1]octan-8-yl) 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | O=C(OC1C2CCC1CN(Cc1ccccc1)C2)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C28H35NO3/c30-27(28(31,24-12-6-2-7-13-24)25-14-8-3-9-15-25)32-26-22-16-17-23(26)20-29(19-22)18-21-10-4-1-5-11-21/h1-2,4-7,10-13,22-23,25-26,31H,3,8-9,14-20H2 |
| InChIKey | PEBZUMQWPCCSTD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |