C28H35NO3 — CID 11532129
(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl) 2-cyclopentyl-2-hydroxy-2-(4-methylphenyl)acetate (PubChem CID 11532129) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is (3-benzyl-3-azabicyclo[3.2.1]octan-8-yl) 2-cyclopentyl-2-hydroxy-2-(4-methylphenyl)acetate.
| Compound Name | (3-benzyl-3-azabicyclo[3.2.1]octan-8-yl) 2-cyclopentyl-2-hydroxy-2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 11532129 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | (3-benzyl-3-azabicyclo[3.2.1]octan-8-yl) 2-cyclopentyl-2-hydroxy-2-(4-methylphenyl)acetate |
| SMILES | Cc1ccc(C(O)(C(=O)OC2C3CCC2CN(Cc2ccccc2)C3)C2CCCC2)cc1 |
| InChI | InChI=1S/C28H35NO3/c1-20-11-15-25(16-12-20)28(31,24-9-5-6-10-24)27(30)32-26-22-13-14-23(26)19-29(18-22)17-21-7-3-2-4-8-21/h2-4,7-8,11-12,15-16,22-24,26,31H,5-6,9-10,13-14,17-19H2,1H3 |
| InChIKey | INQOKIPRVGVYNJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |