C21H30INO3 — CID 69263738
(2,2-dimethyl-2-azoniabicyclo[2.2.1]heptan-7-yl) (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate iodide (PubChem CID 69263738) has the molecular formula C21H30INO3 and a molecular weight of 471.38 g/mol. Its IUPAC name is (2,2-dimethyl-2-azoniabicyclo[2.2.1]heptan-7-yl) (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate iodide.
| Compound Name | (2,2-dimethyl-2-azoniabicyclo[2.2.1]heptan-7-yl) (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate iodide |
|---|---|
| PubChem CID | 69263738 |
| Molecular Formula | C21H30INO3 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (2,2-dimethyl-2-azoniabicyclo[2.2.1]heptan-7-yl) (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate iodide |
| SMILES | C[N+]1(C)CC2CCC1C2OC(=O)[C@](O)(c1ccccc1)C1CCCC1.[I-] |
| InChI | InChI=1S/C21H30NO3.HI/c1-22(2)14-15-12-13-18(22)19(15)25-20(23)21(24,17-10-6-7-11-17)16-8-4-3-5-9-16;/h3-5,8-9,15,17-19,24H,6-7,10-14H2,1-2H3;1H/q+1;/p-1/t15?,18?,19?,21-;/m0./s1 |
| InChIKey | BOGNYMUICMJKEF-XOHXNHKPSA-M |
| XLogP | -0.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|