C23H34INO3 — CID 24894807
[(1S)-2,2-dimethyl-2-azoniabicyclo[2.2.1]heptan-7-yl] 2-cycloheptyl-2-hydroxy-2-phenylacetate iodide (PubChem CID 24894807) has the molecular formula C23H34INO3 and a molecular weight of 499.43 g/mol. Its IUPAC name is [(1S)-2,2-dimethyl-2-azoniabicyclo[2.2.1]heptan-7-yl] 2-cycloheptyl-2-hydroxy-2-phenylacetate iodide.
| Compound Name | [(1S)-2,2-dimethyl-2-azoniabicyclo[2.2.1]heptan-7-yl] 2-cycloheptyl-2-hydroxy-2-phenylacetate iodide |
|---|---|
| PubChem CID | 24894807 |
| Molecular Formula | C23H34INO3 |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | [(1S)-2,2-dimethyl-2-azoniabicyclo[2.2.1]heptan-7-yl] 2-cycloheptyl-2-hydroxy-2-phenylacetate iodide |
| SMILES | C[N+]1(C)CC2CC[C@H]1C2OC(=O)C(O)(c1ccccc1)C1CCCCCC1.[I-] |
| InChI | InChI=1S/C23H34NO3.HI/c1-24(2)16-17-14-15-20(24)21(17)27-22(25)23(26,19-12-8-5-9-13-19)18-10-6-3-4-7-11-18;/h5,8-9,12-13,17-18,20-21,26H,3-4,6-7,10-11,14-16H2,1-2H3;1H/q+1;/p-1/t17?,20-,21?,23?;/m0./s1 |
| InChIKey | TUVUSCDPSCAHMI-NWDBITFSSA-M |
| XLogP | 0.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|