About [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide
[(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide (PubChem CID 53372939) has the molecular formula C21H30BrNO3
and a molecular weight of 424.38 g/mol. Its IUPAC name is [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide.
Molecular Properties
| Compound Name | [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
| PubChem CID | 53372939 |
| Molecular Formula | C21H30BrNO3 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
| SMILES | C[N+]1(C)C2CCC1[C@H](OC(=O)[C@](O)(c1ccccc1)C1CCCC1)C2.[Br-] |
| InChI | InChI=1S/C21H30NO3.BrH/c1-22(2)17-12-13-18(22)19(14-17)25-20(23)21(24,16-10-6-7-11-16)15-8-4-3-5-9-15;/h3-5,8-9,16-19,24H,6-7,10-14H2,1-2H3;1H/q+1;/p-1/t17?,18?,19-,21+;/m1./s1 |
| InChIKey | AXTLCDVPUZHEPY-MNESDYOASA-M |
| XLogP | -0.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide?
The IUPAC name of [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide (CID 53372939) is [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide.
What is the SMILES notation for [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide?
The canonical SMILES for [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide is C[N+]1(C)C2CCC1[C@H](OC(=O)[C@](O)(c1ccccc1)C1CCCC1)C2.[Br-].
What is the InChIKey of [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide?
The InChIKey is AXTLCDVPUZHEPY-MNESDYOASA-M. The full InChI is InChI=1S/C21H30NO3.BrH/c1-22(2)17-12-13-18(22)19(14-17)25-20(23)21(24,16-10-6-7-11-16)15-8-4-3-5-9-15;/h3-5,8-9,16-19,24H,6-7,10-14H2,1-2H3;1H/q+1;/p-1/t17?,18?,19-,21+;/m1./s1.
What are the key properties of [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide?
[(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide has a molecular weight of 424.38 g/mol, XLogP of -0.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-7,7-dimethyl-7-azoniabicyclo[2.2.1]heptan-2-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide is sourced from PubChem (CID 53372939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).