C25H31NO3 — CID 70594500
[3-(pyrrolidin-1-ylmethyl)phenyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 70594500) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is [3-(pyrrolidin-1-ylmethyl)phenyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [3-(pyrrolidin-1-ylmethyl)phenyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 70594500 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | [3-(pyrrolidin-1-ylmethyl)phenyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | O=C(Oc1cccc(CN2CCCC2)c1)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C25H31NO3/c27-24(29-23-15-9-10-20(18-23)19-26-16-7-8-17-26)25(28,21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1,3-4,9-12,15,18,22,28H,2,5-8,13-14,16-17,19H2 |
| InChIKey | HZEAISBCLGSEBQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|