C27H36N2O3 — CID 69369324
[(3R)-3-pyridin-3-yl-4-pyrrolidin-1-ylbutyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 69369324) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is [(3R)-3-pyridin-3-yl-4-pyrrolidin-1-ylbutyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(3R)-3-pyridin-3-yl-4-pyrrolidin-1-ylbutyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 69369324 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | [(3R)-3-pyridin-3-yl-4-pyrrolidin-1-ylbutyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | O=C(OCC[C@@H](CN1CCCC1)c1cccnc1)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C27H36N2O3/c30-26(27(31,24-11-3-1-4-12-24)25-13-5-2-6-14-25)32-19-15-23(21-29-17-7-8-18-29)22-10-9-16-28-20-22/h1,3-4,9-12,16,20,23,25,31H,2,5-8,13-15,17-19,21H2/t23-,27?/m0/s1 |
| InChIKey | UXMDAPCMJHOGKX-DCCUJTHKSA-N |
| XLogP | 4.66 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |