C25H33N3O3 — CID 69369422
[3-[(3R)-piperidin-3-yl]-2-pyrimidin-5-ylpropyl] 2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 69369422) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is [3-[(3R)-piperidin-3-yl]-2-pyrimidin-5-ylpropyl] 2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | [3-[(3R)-piperidin-3-yl]-2-pyrimidin-5-ylpropyl] 2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 69369422 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | [3-[(3R)-piperidin-3-yl]-2-pyrimidin-5-ylpropyl] 2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | O=C(OCC(C[C@H]1CCCNC1)c1cncnc1)C(O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C25H33N3O3/c29-24(25(30,23-10-4-5-11-23)22-8-2-1-3-9-22)31-17-20(21-15-27-18-28-16-21)13-19-7-6-12-26-14-19/h1-3,8-9,15-16,18-20,23,26,30H,4-7,10-14,17H2/t19-,20?,25?/m1/s1 |
| InChIKey | TZKDPIVPZHQQJQ-USEFPYCQSA-N |
| XLogP | 3.57 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |