C26H29N3O3 — CID 69370169
(3-piperidin-4-yl-2-pyrazin-2-ylpropyl) 2-hydroxy-2,2-diphenylacetate (PubChem CID 69370169) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is (3-piperidin-4-yl-2-pyrazin-2-ylpropyl) 2-hydroxy-2,2-diphenylacetate.
| Compound Name | (3-piperidin-4-yl-2-pyrazin-2-ylpropyl) 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 69370169 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (3-piperidin-4-yl-2-pyrazin-2-ylpropyl) 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(OCC(CC1CCNCC1)c1cnccn1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O3/c30-25(26(31,22-7-3-1-4-8-22)23-9-5-2-6-10-23)32-19-21(24-18-28-15-16-29-24)17-20-11-13-27-14-12-20/h1-10,15-16,18,20-21,27,31H,11-14,17,19H2 |
| InChIKey | ZWWFGBROMXVCDE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |