C27H37N3O3 — CID 69370425
(4-piperidin-4-yl-2-pyrimidin-2-ylbutyl) 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 69370425) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is (4-piperidin-4-yl-2-pyrimidin-2-ylbutyl) 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | (4-piperidin-4-yl-2-pyrimidin-2-ylbutyl) 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 69370425 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | (4-piperidin-4-yl-2-pyrimidin-2-ylbutyl) 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | O=C(OCC(CCC1CCNCC1)c1ncccn1)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C27H37N3O3/c31-26(27(32,23-8-3-1-4-9-23)24-10-5-2-6-11-24)33-20-22(25-29-16-7-17-30-25)13-12-21-14-18-28-19-15-21/h1,3-4,7-9,16-17,21-22,24,28,32H,2,5-6,10-15,18-20H2 |
| InChIKey | NHQANONLIPYHAQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |