C26H35N3O3 — CID 69371647
[3-[(3R)-piperidin-3-yl]-2-pyrazin-2-ylpropyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 69371647) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is [3-[(3R)-piperidin-3-yl]-2-pyrazin-2-ylpropyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [3-[(3R)-piperidin-3-yl]-2-pyrazin-2-ylpropyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 69371647 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | [3-[(3R)-piperidin-3-yl]-2-pyrazin-2-ylpropyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | O=C(OCC(C[C@H]1CCCNC1)c1cnccn1)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C26H35N3O3/c30-25(26(31,22-9-3-1-4-10-22)23-11-5-2-6-12-23)32-19-21(24-18-28-14-15-29-24)16-20-8-7-13-27-17-20/h1,3-4,9-10,14-15,18,20-21,23,27,31H,2,5-8,11-13,16-17,19H2/t20-,21?,26?/m1/s1 |
| InChIKey | GXUFYRNNCWSBFC-BGPPBHKUSA-N |
| XLogP | 3.96 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |