C22H36NO3+ — CID 3096350
3-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxypropyl-diethyl-methylazanium (PubChem CID 3096350) has the molecular formula C22H36NO3+ and a molecular weight of 362.53 g/mol. Its IUPAC name is 3-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxypropyl-diethyl-methylazanium.
| Compound Name | 3-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxypropyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 3096350 |
| Molecular Formula | C22H36NO3+ |
| Molecular Weight | 362.53 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 3-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxypropyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CCCOC(=O)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H36NO3/c1-4-23(3,5-2)17-12-18-26-21(24)22(25,19-13-8-6-9-14-19)20-15-10-7-11-16-20/h6,8-9,13-14,20,25H,4-5,7,10-12,15-18H2,1-3H3/q+1 |
| InChIKey | HYOGOHCWSSHCPS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|