C25H31FINO5 — CID 163331616
2-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)oxyethyl-[(3-fluorobenzoyl)oxymethyl]-dimethylazanium iodide (PubChem CID 163331616) has the molecular formula C25H31FINO5 and a molecular weight of 571.43 g/mol. Its IUPAC name is 2-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)oxyethyl-[(3-fluorobenzoyl)oxymethyl]-dimethylazanium iodide.
| Compound Name | 2-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)oxyethyl-[(3-fluorobenzoyl)oxymethyl]-dimethylazanium iodide |
|---|---|
| PubChem CID | 163331616 |
| Molecular Formula | C25H31FINO5 |
| Molecular Weight | 571.43 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | 2-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)oxyethyl-[(3-fluorobenzoyl)oxymethyl]-dimethylazanium iodide |
| SMILES | C[N+](C)(CCOC(=O)C(O)(c1ccccc1)C1CCCC1)COC(=O)c1cccc(F)c1.[I-] |
| InChI | InChI=1S/C25H31FNO5.HI/c1-27(2,18-32-23(28)19-9-8-14-22(26)17-19)15-16-31-24(29)25(30,21-12-6-7-13-21)20-10-4-3-5-11-20;/h3-5,8-11,14,17,21,30H,6-7,12-13,15-16,18H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NOGDBALCWFWTBV-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|