C26H42NO5+ — CID 3095366
2-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)oxyethyl-dimethyl-(2-propylpentanoyloxymethyl)azanium (PubChem CID 3095366) has the molecular formula C26H42NO5+ and a molecular weight of 448.62 g/mol. Its IUPAC name is 2-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)oxyethyl-dimethyl-(2-propylpentanoyloxymethyl)azanium.
| Compound Name | 2-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)oxyethyl-dimethyl-(2-propylpentanoyloxymethyl)azanium |
|---|---|
| PubChem CID | 3095366 |
| Molecular Formula | C26H42NO5+ |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | 2-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)oxyethyl-dimethyl-(2-propylpentanoyloxymethyl)azanium |
| SMILES | CCCC(CCC)C(=O)OC[N+](C)(C)CCOC(=O)C(O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C26H42NO5/c1-5-12-21(13-6-2)24(28)32-20-27(3,4)18-19-31-25(29)26(30,23-16-10-11-17-23)22-14-8-7-9-15-22/h7-9,14-15,21,23,30H,5-6,10-13,16-20H2,1-4H3/q+1 |
| InChIKey | OFXFCIJROMJWPW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|