C23H38NO3+ — CID 7377908
3-[(2R)-2-cyclohexyl-2-hydroxy-2-phenylacetyl]oxypropyl-triethylazanium (PubChem CID 7377908) has the molecular formula C23H38NO3+ and a molecular weight of 376.56 g/mol. Its IUPAC name is 3-[(2R)-2-cyclohexyl-2-hydroxy-2-phenylacetyl]oxypropyl-triethylazanium.
| Compound Name | 3-[(2R)-2-cyclohexyl-2-hydroxy-2-phenylacetyl]oxypropyl-triethylazanium |
|---|---|
| PubChem CID | 7377908 |
| Molecular Formula | C23H38NO3+ |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 3-[(2R)-2-cyclohexyl-2-hydroxy-2-phenylacetyl]oxypropyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CCCOC(=O)[C@](O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C23H38NO3/c1-4-24(5-2,6-3)18-13-19-27-22(25)23(26,20-14-9-7-10-15-20)21-16-11-8-12-17-21/h7,9-10,14-15,21,26H,4-6,8,11-13,16-19H2,1-3H3/q+1/t23-/m0/s1 |
| InChIKey | XMIWOWDHZRSTMW-QHCPKHFHSA-N |
| XLogP | 4.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|