C30H45N2O3+ — CID 129318350
4-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxybut-2-ynyl-[4-(diethylamino)but-2-ynyl]-diethylazanium (PubChem CID 129318350) has the molecular formula C30H45N2O3+ and a molecular weight of 481.70 g/mol. Its IUPAC name is 4-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxybut-2-ynyl-[4-(diethylamino)but-2-ynyl]-diethylazanium.
| Compound Name | 4-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxybut-2-ynyl-[4-(diethylamino)but-2-ynyl]-diethylazanium |
|---|---|
| PubChem CID | 129318350 |
| Molecular Formula | C30H45N2O3+ |
| Molecular Weight | 481.70 g/mol |
| Exact Mass | 481.34 |
| IUPAC Name | 4-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxybut-2-ynyl-[4-(diethylamino)but-2-ynyl]-diethylazanium |
| SMILES | CCN(CC)CC#CC[N+](CC)(CC)CC#CCOC(=O)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C30H45N2O3/c1-5-31(6-2)23-15-16-24-32(7-3,8-4)25-17-18-26-35-29(33)30(34,27-19-11-9-12-20-27)28-21-13-10-14-22-28/h9,11-12,19-20,28,34H,5-8,10,13-14,21-26H2,1-4H3/q+1 |
| InChIKey | OWCUITJOHJWUQW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.70 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|