C33H54N8O3 — CID 70976674
4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;2-N,2-N,4-N,4-N-tetraethyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine (PubChem CID 70976674) has the molecular formula C33H54N8O3 and a molecular weight of 610.85 g/mol. Its IUPAC name is 4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;2-N,2-N,4-N,4-N-tetraethyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;2-N,2-N,4-N,4-N-tetraethyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 70976674 |
| Molecular Formula | C33H54N8O3 |
| Molecular Weight | 610.85 g/mol |
| Exact Mass | 610.43 |
| IUPAC Name | 4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;2-N,2-N,4-N,4-N-tetraethyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)CC#CCOC(=O)C(O)(c1ccccc1)C1CCCCC1.CCN(CC)c1nc(NN)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C22H31NO3.C11H23N7/c1-3-23(4-2)17-11-12-18-26-21(24)22(25,19-13-7-5-8-14-19)20-15-9-6-10-16-20;1-5-17(6-2)10-13-9(16-12)14-11(15-10)18(7-3)8-4/h5,7-8,13-14,20,25H,3-4,6,9-10,15-18H2,1-2H3;5-8,12H2,1-4H3,(H,13,14,15,16) |
| InChIKey | PSKYLPOWDBITQR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.85 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|