C19H24O6S — CID 59397490
4-methylsulfonyloxybut-2-ynyl (2R)-2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 59397490) has the molecular formula C19H24O6S and a molecular weight of 380.46 g/mol. Its IUPAC name is 4-methylsulfonyloxybut-2-ynyl (2R)-2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | 4-methylsulfonyloxybut-2-ynyl (2R)-2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 59397490 |
| Molecular Formula | C19H24O6S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-methylsulfonyloxybut-2-ynyl (2R)-2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | CS(=O)(=O)OCC#CCOC(=O)[C@](O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C19H24O6S/c1-26(22,23)25-15-9-8-14-24-18(20)19(21,16-10-4-2-5-11-16)17-12-6-3-7-13-17/h2,4-5,10-11,17,21H,3,6-7,12-15H2,1H3/t19-/m0/s1 |
| InChIKey | APUNFSMRTMCNDF-IBGZPJMESA-N |
| XLogP | 1.98 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|