C22H31NO3 — CID 175476357
but-2-ynyl 2-cyclohexyl-2-[4-(diethylamino)phenyl]-2-hydroxyacetate (PubChem CID 175476357) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is but-2-ynyl 2-cyclohexyl-2-[4-(diethylamino)phenyl]-2-hydroxyacetate.
| Compound Name | but-2-ynyl 2-cyclohexyl-2-[4-(diethylamino)phenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 175476357 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | but-2-ynyl 2-cyclohexyl-2-[4-(diethylamino)phenyl]-2-hydroxyacetate |
| SMILES | CC#CCOC(=O)C(O)(c1ccc(N(CC)CC)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H31NO3/c1-4-7-17-26-21(24)22(25,18-11-9-8-10-12-18)19-13-15-20(16-14-19)23(5-2)6-3/h13-16,18,25H,5-6,8-12,17H2,1-3H3 |
| InChIKey | DONULWNCBNQKGC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|