C22H32ClNO3 — CID 169445197
[(Z)-2-chloro-4-(diethylamino)but-2-enyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 169445197) has the molecular formula C22H32ClNO3 and a molecular weight of 393.96 g/mol. Its IUPAC name is [(Z)-2-chloro-4-(diethylamino)but-2-enyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(Z)-2-chloro-4-(diethylamino)but-2-enyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 169445197 |
| Molecular Formula | C22H32ClNO3 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | [(Z)-2-chloro-4-(diethylamino)but-2-enyl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | CCN(CC)C/C=C(\Cl)COC(=O)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H32ClNO3/c1-3-24(4-2)16-15-20(23)17-27-21(25)22(26,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5,7-8,11-12,15,19,26H,3-4,6,9-10,13-14,16-17H2,1-2H3/b20-15- |
| InChIKey | KRGMKEHZOIAINB-HKWRFOASSA-N |
| XLogP | 4.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |