C25H35NO3 — CID 16718162
[(1S,5R)-3-(3-methylbut-2-enyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 16718162) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is [(1S,5R)-3-(3-methylbut-2-enyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(1S,5R)-3-(3-methylbut-2-enyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 16718162 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | [(1S,5R)-3-(3-methylbut-2-enyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | CC(C)=CCN1C[C@@H]2C(COC(=O)C(O)(c3ccccc3)C3CCCCC3)[C@@H]2C1 |
| InChI | InChI=1S/C25H35NO3/c1-18(2)13-14-26-15-21-22(16-26)23(21)17-29-24(27)25(28,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3,5-6,9-10,13,20-23,28H,4,7-8,11-12,14-17H2,1-2H3/t21-,22+,23?,25? |
| InChIKey | YIUIMSLLPGKBST-PMLGBOFDSA-N |
| XLogP | 4.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|