C25H37N3O2 — CID 16718142
2-cyclopentyl-2-hydroxy-N-[[[(1R,5S)-3-(4-methylpent-3-enyl)-3-azabicyclo[3.1.0]hexan-6-yl]amino]methyl]-2-phenylacetamide (PubChem CID 16718142) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 2-cyclopentyl-2-hydroxy-N-[[[(1R,5S)-3-(4-methylpent-3-enyl)-3-azabicyclo[3.1.0]hexan-6-yl]amino]methyl]-2-phenylacetamide.
| Compound Name | 2-cyclopentyl-2-hydroxy-N-[[[(1R,5S)-3-(4-methylpent-3-enyl)-3-azabicyclo[3.1.0]hexan-6-yl]amino]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 16718142 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | 2-cyclopentyl-2-hydroxy-N-[[[(1R,5S)-3-(4-methylpent-3-enyl)-3-azabicyclo[3.1.0]hexan-6-yl]amino]methyl]-2-phenylacetamide |
| SMILES | CC(C)=CCCN1C[C@@H]2C(NCNC(=O)C(O)(c3ccccc3)C3CCCC3)[C@@H]2C1 |
| InChI | InChI=1S/C25H37N3O2/c1-18(2)9-8-14-28-15-21-22(16-28)23(21)26-17-27-24(29)25(30,20-12-6-7-13-20)19-10-4-3-5-11-19/h3-5,9-11,20-23,26,30H,6-8,12-17H2,1-2H3,(H,27,29)/t21-,22+,23?,25? |
| InChIKey | ZDQIBUJAUXXMSG-PMLGBOFDSA-N |
| XLogP | 3.01 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|