C19H28ClN3O2 — CID 11653500
(2S)-N-[(3-azabicyclo[3.1.0]hexan-6-ylamino)methyl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide;hydrochloride (PubChem CID 11653500) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is (2S)-N-[(3-azabicyclo[3.1.0]hexan-6-ylamino)methyl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide;hydrochloride.
| Compound Name | (2S)-N-[(3-azabicyclo[3.1.0]hexan-6-ylamino)methyl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 11653500 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (2S)-N-[(3-azabicyclo[3.1.0]hexan-6-ylamino)methyl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide;hydrochloride |
| SMILES | Cl.O=C(NCNC1C2CNCC21)[C@@](O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H27N3O2.ClH/c23-18(22-12-21-17-15-10-20-11-16(15)17)19(24,14-8-4-5-9-14)13-6-2-1-3-7-13;/h1-3,6-7,14-17,20-21,24H,4-5,8-12H2,(H,22,23);1H/t15?,16?,17?,19-;/m1./s1 |
| InChIKey | SMPSRLXDNPVGDS-SHJDDOMSSA-N |
| XLogP | 1.37 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|