C21H31ClN2O2 — CID 19775509
2-cyclohexyl-2-hydroxy-2-phenyl-N-[4-(propan-2-ylamino)but-2-ynyl]acetamide;hydrochloride (PubChem CID 19775509) has the molecular formula C21H31ClN2O2 and a molecular weight of 378.94 g/mol. Its IUPAC name is 2-cyclohexyl-2-hydroxy-2-phenyl-N-[4-(propan-2-ylamino)but-2-ynyl]acetamide;hydrochloride.
| Compound Name | 2-cyclohexyl-2-hydroxy-2-phenyl-N-[4-(propan-2-ylamino)but-2-ynyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 19775509 |
| Molecular Formula | C21H31ClN2O2 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2-cyclohexyl-2-hydroxy-2-phenyl-N-[4-(propan-2-ylamino)but-2-ynyl]acetamide;hydrochloride |
| SMILES | CC(C)NCC#CCNC(=O)C(O)(c1ccccc1)C1CCCCC1.Cl |
| InChI | InChI=1S/C21H30N2O2.ClH/c1-17(2)22-15-9-10-16-23-20(24)21(25,18-11-5-3-6-12-18)19-13-7-4-8-14-19;/h3,5-6,11-12,17,19,22,25H,4,7-8,13-16H2,1-2H3,(H,23,24);1H |
| InChIKey | BXPMWEPZKWWKPC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|