C25H38N2O2 — CID 10476022
2-cyclopentyl-N-[(1R,5S)-3-heptyl-3-azabicyclo[3.1.0]hexan-6-yl]-2-hydroxy-2-phenylacetamide (PubChem CID 10476022) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(1R,5S)-3-heptyl-3-azabicyclo[3.1.0]hexan-6-yl]-2-hydroxy-2-phenylacetamide.
| Compound Name | 2-cyclopentyl-N-[(1R,5S)-3-heptyl-3-azabicyclo[3.1.0]hexan-6-yl]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 10476022 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | 2-cyclopentyl-N-[(1R,5S)-3-heptyl-3-azabicyclo[3.1.0]hexan-6-yl]-2-hydroxy-2-phenylacetamide |
| SMILES | CCCCCCCN1C[C@@H]2C(NC(=O)C(O)(c3ccccc3)C3CCCC3)[C@@H]2C1 |
| InChI | InChI=1S/C25H38N2O2/c1-2-3-4-5-11-16-27-17-21-22(18-27)23(21)26-24(28)25(29,20-14-9-10-15-20)19-12-7-6-8-13-19/h6-8,12-13,20-23,29H,2-5,9-11,14-18H2,1H3,(H,26,28)/t21-,22+,23?,25? |
| InChIKey | SSRRYYYOKRBRSY-PMLGBOFDSA-N |
| XLogP | 4.08 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|