C23H34N2O2 — CID 10067773
N-(3-butyl-3-azabicyclo[3.1.0]hexan-6-yl)-2-cyclohexyl-2-hydroxy-2-phenylacetamide (PubChem CID 10067773) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is N-(3-butyl-3-azabicyclo[3.1.0]hexan-6-yl)-2-cyclohexyl-2-hydroxy-2-phenylacetamide.
| Compound Name | N-(3-butyl-3-azabicyclo[3.1.0]hexan-6-yl)-2-cyclohexyl-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 10067773 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | N-(3-butyl-3-azabicyclo[3.1.0]hexan-6-yl)-2-cyclohexyl-2-hydroxy-2-phenylacetamide |
| SMILES | CCCCN1CC2C(C1)C2NC(=O)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C23H34N2O2/c1-2-3-14-25-15-19-20(16-25)21(19)24-22(26)23(27,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4,6-7,10-11,18-21,27H,2-3,5,8-9,12-16H2,1H3,(H,24,26) |
| InChIKey | RAPQAGYQQLBWKW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |