C28H38FN2O3+ — CID 154485269
[1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-(4-fluorophenoxy)ethyl]-dimethylazanium (PubChem CID 154485269) has the molecular formula C28H38FN2O3+ and a molecular weight of 469.62 g/mol. Its IUPAC name is [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-(4-fluorophenoxy)ethyl]-dimethylazanium.
| Compound Name | [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-(4-fluorophenoxy)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 154485269 |
| Molecular Formula | C28H38FN2O3+ |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-(4-fluorophenoxy)ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCOc1ccc(F)cc1)C1CCN(C(=O)C(O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C28H38FN2O3/c1-31(2,20-21-34-26-14-12-24(29)13-15-26)25-16-18-30(19-17-25)27(32)28(33,23-10-6-7-11-23)22-8-4-3-5-9-22/h3-5,8-9,12-15,23,25,33H,6-7,10-11,16-21H2,1-2H3/q+1 |
| InChIKey | WEORZQYHFWXYSS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|