C28H37Cl2N2O2+ — CID 157382016
[1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-(2,4-dichlorophenyl)ethyl]-dimethylazanium (PubChem CID 157382016) has the molecular formula C28H37Cl2N2O2+ and a molecular weight of 504.52 g/mol. Its IUPAC name is [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-(2,4-dichlorophenyl)ethyl]-dimethylazanium.
| Compound Name | [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-(2,4-dichlorophenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 157382016 |
| Molecular Formula | C28H37Cl2N2O2+ |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | [1-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperidin-4-yl]-[2-(2,4-dichlorophenyl)ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCc1ccc(Cl)cc1Cl)C1CCN(C(=O)C(O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C28H37Cl2N2O2/c1-32(2,19-16-21-12-13-24(29)20-26(21)30)25-14-17-31(18-15-25)27(33)28(34,23-10-6-7-11-23)22-8-4-3-5-9-22/h3-5,8-9,12-13,20,23,25,34H,6-7,10-11,14-19H2,1-2H3/q+1 |
| InChIKey | BKZMEAZFSHKXEP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|