C29H41N2O2+ — CID 25103370
[1-[2-cyclopentyl-2-hydroxy-2-(4-methylphenyl)acetyl]piperidin-4-yl]-dimethyl-(2-phenylethyl)azanium (PubChem CID 25103370) has the molecular formula C29H41N2O2+ and a molecular weight of 449.66 g/mol. Its IUPAC name is [1-[2-cyclopentyl-2-hydroxy-2-(4-methylphenyl)acetyl]piperidin-4-yl]-dimethyl-(2-phenylethyl)azanium.
| Compound Name | [1-[2-cyclopentyl-2-hydroxy-2-(4-methylphenyl)acetyl]piperidin-4-yl]-dimethyl-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 25103370 |
| Molecular Formula | C29H41N2O2+ |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.32 |
| IUPAC Name | [1-[2-cyclopentyl-2-hydroxy-2-(4-methylphenyl)acetyl]piperidin-4-yl]-dimethyl-(2-phenylethyl)azanium |
| SMILES | Cc1ccc(C(O)(C(=O)N2CCC([N+](C)(C)CCc3ccccc3)CC2)C2CCCC2)cc1 |
| InChI | InChI=1S/C29H41N2O2/c1-23-13-15-26(16-14-23)29(33,25-11-7-8-12-25)28(32)30-20-17-27(18-21-30)31(2,3)22-19-24-9-5-4-6-10-24/h4-6,9-10,13-16,25,27,33H,7-8,11-12,17-22H2,1-3H3/q+1 |
| InChIKey | HFZFQBLQLXXBJO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|