C26H34N2O2 — CID 122664443
2-cyclopentyl-2-hydroxy-2-phenyl-1-[4-(3-phenylpropyl)piperazin-1-yl]ethanone (PubChem CID 122664443) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 2-cyclopentyl-2-hydroxy-2-phenyl-1-[4-(3-phenylpropyl)piperazin-1-yl]ethanone.
| Compound Name | 2-cyclopentyl-2-hydroxy-2-phenyl-1-[4-(3-phenylpropyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122664443 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 2-cyclopentyl-2-hydroxy-2-phenyl-1-[4-(3-phenylpropyl)piperazin-1-yl]ethanone |
| SMILES | O=C(N1CCN(CCCc2ccccc2)CC1)C(O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C26H34N2O2/c29-25(26(30,24-15-7-8-16-24)23-13-5-2-6-14-23)28-20-18-27(19-21-28)17-9-12-22-10-3-1-4-11-22/h1-6,10-11,13-14,24,30H,7-9,12,15-21H2 |
| InChIKey | FIKSRTWMJKSRKO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |