C26H33N5O3 — CID 67242446
4-[[[amino-[4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperazin-1-yl]methylidene]amino]methyl]benzamide (PubChem CID 67242446) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 4-[[[amino-[4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperazin-1-yl]methylidene]amino]methyl]benzamide.
| Compound Name | 4-[[[amino-[4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperazin-1-yl]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 67242446 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 4-[[[amino-[4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperazin-1-yl]methylidene]amino]methyl]benzamide |
| SMILES | NC(=O)c1ccc(C/N=C(\N)N2CCN(C(=O)[C@](O)(c3ccccc3)C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C26H33N5O3/c27-23(32)20-12-10-19(11-13-20)18-29-25(28)31-16-14-30(15-17-31)24(33)26(34,22-8-4-5-9-22)21-6-2-1-3-7-21/h1-3,6-7,10-13,22,34H,4-5,8-9,14-18H2,(H2,27,32)(H2,28,29)/t26-/m0/s1 |
| InChIKey | MQUMNTQLLGIPRN-SANMLTNESA-N |
| XLogP | 1.82 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|