C25H30F2N4O2 — CID 25221075
4-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)-N'-[(3,4-difluorophenyl)methyl]piperazine-1-carboximidamide (PubChem CID 25221075) has the molecular formula C25H30F2N4O2 and a molecular weight of 456.54 g/mol. Its IUPAC name is 4-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)-N'-[(3,4-difluorophenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)-N'-[(3,4-difluorophenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 25221075 |
| Molecular Formula | C25H30F2N4O2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 4-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)-N'-[(3,4-difluorophenyl)methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(F)c(F)c1)N1CCN(C(=O)C(O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C25H30F2N4O2/c26-21-11-10-18(16-22(21)27)17-29-24(28)31-14-12-30(13-15-31)23(32)25(33,20-8-4-5-9-20)19-6-2-1-3-7-19/h1-3,6-7,10-11,16,20,33H,4-5,8-9,12-15,17H2,(H2,28,29) |
| InChIKey | HSFCFQANEREPMZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|