C25H32N4O3 — CID 67243344
4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-N'-(4-methoxyphenyl)piperazine-1-carboximidamide (PubChem CID 67243344) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-N'-(4-methoxyphenyl)piperazine-1-carboximidamide.
| Compound Name | 4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-N'-(4-methoxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 67243344 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-N'-(4-methoxyphenyl)piperazine-1-carboximidamide |
| SMILES | COc1ccc(/N=C(\N)N2CCN(C(=O)[C@](O)(c3ccccc3)C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C25H32N4O3/c1-32-22-13-11-21(12-14-22)27-24(26)29-17-15-28(16-18-29)23(30)25(31,20-9-5-6-10-20)19-7-3-2-4-8-19/h2-4,7-8,11-14,20,31H,5-6,9-10,15-18H2,1H3,(H2,26,27)/t25-/m0/s1 |
| InChIKey | KSQKBRWTWLYCHD-VWLOTQADSA-N |
| XLogP | 2.86 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|