C26H31F3N4O3 — CID 25221644
4-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)-N'-[[4-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 25221644) has the molecular formula C26H31F3N4O3 and a molecular weight of 504.55 g/mol. Its IUPAC name is 4-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)-N'-[[4-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)-N'-[[4-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 25221644 |
| Molecular Formula | C26H31F3N4O3 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 4-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)-N'-[[4-(trifluoromethoxy)phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(OC(F)(F)F)cc1)N1CCN(C(=O)C(O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C26H31F3N4O3/c27-26(28,29)36-22-12-10-19(11-13-22)18-31-24(30)33-16-14-32(15-17-33)23(34)25(35,21-8-4-5-9-21)20-6-2-1-3-7-20/h1-3,6-7,10-13,21,35H,4-5,8-9,14-18H2,(H2,30,31) |
| InChIKey | WEMQIHCUJXQKTM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|