C25H31FN4O2 — CID 67243226
4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-N'-[(3-fluorophenyl)methyl]piperazine-1-carboximidamide (PubChem CID 67243226) has the molecular formula C25H31FN4O2 and a molecular weight of 438.55 g/mol. Its IUPAC name is 4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-N'-[(3-fluorophenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-N'-[(3-fluorophenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 67243226 |
| Molecular Formula | C25H31FN4O2 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-N'-[(3-fluorophenyl)methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1cccc(F)c1)N1CCN(C(=O)[C@](O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C25H31FN4O2/c26-22-12-6-7-19(17-22)18-28-24(27)30-15-13-29(14-16-30)23(31)25(32,21-10-4-5-11-21)20-8-2-1-3-9-20/h1-3,6-9,12,17,21,32H,4-5,10-11,13-16,18H2,(H2,27,28)/t25-/m0/s1 |
| InChIKey | VROWFAULMWBQKB-VWLOTQADSA-N |
| XLogP | 2.86 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|